cas: 188970-92-5 — see every product listed under this CAS number, including other names
Fmoc-Dap(Alloc)-OH 95% (CAS 188970-92-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210001-1g |
| cas | 188970-92-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 442.69 Pln | |
| Ambeed | 25g | 998.94 Pln | |
| Ambeed | 100g | 3774.62 Pln | |
| Ambeed | 500g | 14882.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210001 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid (CAS 188970-92-5) is a chemical compound with the molecular formula C22H22N2O6 and a molecular weight of 410.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: MPVGCCAXXFLGIU-IBGZPJMESA-N.
| Molecular formula | C22H22N2O6 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | MPVGCCAXXFLGIU-IBGZPJMESA-N |
| SMILES | C=CCOC(=O)NC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)