Products 446826-08-0

CAS 446826-08-0 is the registry number for 2,2'-((Cyclohexane-1,2-diylbis(azanediyl))bis(carbonyl))dibenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[2-[(2-carboxybenzoyl)amino]cyclohexyl]carbamoyl]benzoic acid (CAS 446826-08-0) is a chemical compound with the molecular formula C22H22N2O6 and a molecular weight of 410.4 g/mol. IUPAC name: 2-[[2-[(2-carboxybenzoyl)amino]cyclohexyl]carbamoyl]benzoic acid. InChIKey: LTZRWEQGADQLBS-UHFFFAOYSA-N.

Identity
Molecular formulaC22H22N2O6
Molecular weight410.4 g/mol
IUPAC name2-[[2-[(2-carboxybenzoyl)amino]cyclohexyl]carbamoyl]benzoic acid
InChIKeyLTZRWEQGADQLBS-UHFFFAOYSA-N
SMILESC1CCC(C(C1)NC(=O)C2=CC=CC=C2C(=O)O)NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)