cas: 132327-80-1 — see every product listed under this CAS number, including other names
Fmoc-Gln(Trt)-OH 98% (CAS 132327-80-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213511-1g |
| cas | 132327-80-1 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 426.00 Pln | |
| Ambeed | 500g | 1510.69 Pln | |
| Ambeed | 1000g | 2534.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A213511 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid (CAS 132327-80-1) is a chemical compound with the molecular formula C39H34N2O5 and a molecular weight of 610.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid. InChIKey: WDGICUODAOGOMO-DHUJRADRSA-N.
| Molecular formula | C39H34N2O5 |
|---|---|
| Molecular weight | 610.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid |
| InChIKey | WDGICUODAOGOMO-DHUJRADRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)