cas: 132327-80-1 — see every product listed under this CAS number, including other names
Fmoc-Gln(Trt)-OH, 99.96% (CAS 132327-80-1) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 250 g, 100 g, 10 g, 1000 g, 10mM/1mL, 25 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013081-500 g |
| cas | 132327-80-1 |
| size | 500 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 1508.56 Pln | |
| MedChemExpress | 250 g | 983.78 Pln | |
| MedChemExpress | 100 g | 533.32 Pln | |
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 1000 g | 2339.83 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 50 g | 366.13 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid (CAS 132327-80-1) is a chemical compound with the molecular formula C39H34N2O5 and a molecular weight of 610.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid. InChIKey: WDGICUODAOGOMO-DHUJRADRSA-N.
| Molecular formula | C39H34N2O5 |
|---|---|
| Molecular weight | 610.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid |
| InChIKey | WDGICUODAOGOMO-DHUJRADRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)