Fmoc-Gly-Thr(psi(Me,Me)pro)-OH 97%
cas: 1262308-49-5 — see every product listed under this CAS number, including other names
Fmoc-Gly-Thr(psi(Me,Me)pro)-OH 97% (CAS 1262308-49-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194563-100mg |
| cas | 1262308-49-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 10g | 2033.56 Pln | |
| Ambeed | 25g | 3813.56 Pln | |
| Ambeed | 100g | 12051.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194563 |
(4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1262308-49-5) is a chemical compound with the molecular formula C24H26N2O6 and a molecular weight of 438.5 g/mol. IUPAC name: (4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: NUXZZZZUNKUMGM-SZNDQCEHSA-N.
| Molecular formula | C24H26N2O6 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (4S,5R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | NUXZZZZUNKUMGM-SZNDQCEHSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Gly-Thr[Psi(Me,Me)Pro]-OH, Fmoc-Gly-Thr(Psi(Me,Me)pro)-OH, fmoc-gly-thr(psi me,me pro)-oh, Fmoc-Gly-Thr(Psime,Mepro)-OH, Fmoc-Gly-L-Thr(Psi(Me,Me)pro)-OH, Fmoc-Gly-L-Thr[PSI(Me,Me)Pro]-OH, Fmoc-Gly-PsiProThr-OH, orb1303638, Fmoc-Gly-Thr(|xMe,Mepro)-OH, Fmoc-Gly-Thr[Psi(Me,Me)Pro]-OH>/= 99% (HPLC)