cas: 84891-19-0 — see every product listed under this CAS number, including other names
Fmoc-His(3-Bom)-OH 95% (CAS 84891-19-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A625226-1g |
| cas | 84891-19-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1037.88 Pln | |
| Ambeed | 25g | 2089.19 Pln | |
| Ambeed | 100g | 7139.94 Pln | |
| Ambeed | 500g | 33928.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A625226 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid (CAS 84891-19-0) is a chemical compound with the molecular formula C29H27N3O5 and a molecular weight of 497.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid. InChIKey: CJBFCDKGOPEUOF-MHZLTWQESA-N.
| Molecular formula | C29H27N3O5 |
|---|---|
| Molecular weight | 497.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid |
| InChIKey | CJBFCDKGOPEUOF-MHZLTWQESA-N |
| SMILES | C1=CC=C(C=C1)COCN2C=NC=C2C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)