Products 2923574-11-0

CAS 2923574-11-0 is the registry number for CDK2 degrader 5, 99.17%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

(2-methyl-3-phenylphenyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate (CAS 2923574-11-0) is a chemical compound with the molecular formula C29H27N3O5 and a molecular weight of 497.5 g/mol. IUPAC name: (2-methyl-3-phenylphenyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate. InChIKey: LIOOTCIQHPYMKB-UHFFFAOYSA-N.

Identity
Molecular formulaC29H27N3O5
Molecular weight497.5 g/mol
IUPAC name(2-methyl-3-phenylphenyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate
InChIKeyLIOOTCIQHPYMKB-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1C2=CC=CC=C2)COC(=O)NCC3=CC4=C(CN(C4=O)C5CCC(=O)NC5=O)C=C3

Computed by PubChem (NCBI)

Synonyms: orb2945212