cas: 98929-98-7 — see every product listed under this CAS number, including other names
Fmoc-His(Fmoc)-OH, 98%, 98% (CAS 98929-98-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1177L7-1g |
| cas | 98929-98-7 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 894.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid (CAS 98929-98-7) is a chemical compound with the molecular formula C36H29N3O6 and a molecular weight of 599.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid. InChIKey: WTBXFPFCUZKREB-XIFFEERXSA-N.
| Molecular formula | C36H29N3O6 |
|---|---|
| Molecular weight | 599.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid |
| InChIKey | WTBXFPFCUZKREB-XIFFEERXSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CN(C=N4)C(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57)C(=O)O |
Computed by PubChem (NCBI)