cas: 98929-98-7 — see every product listed under this CAS number, including other names
Fmoc-His(Fmoc)-OH, 98.0% (CAS 98929-98-7) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 5 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013083-25 g |
| cas | 98929-98-7 |
| size | 25 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 412.57 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1137.04 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 98.0% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid (CAS 98929-98-7) is a chemical compound with the molecular formula C36H29N3O6 and a molecular weight of 599.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid. InChIKey: WTBXFPFCUZKREB-XIFFEERXSA-N.
| Molecular formula | C36H29N3O6 |
|---|---|
| Molecular weight | 599.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid |
| InChIKey | WTBXFPFCUZKREB-XIFFEERXSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CN(C=N4)C(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57)C(=O)O |
Computed by PubChem (NCBI)