cas: 109425-51-6 — see every product listed under this CAS number, including other names
Fmoc-His(Trt)-OH, 98% (CAS 109425-51-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03415-1G |
| cas | 109425-51-6 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 15g | 112.48 Pln | |
| Fluorochem | 25g | 148.92 Pln | |
| Fluorochem | 100g | 242.64 Pln | |
| Fluorochem | 500g | 945.52 Pln | |
| Fluorochem | 1kg | 1768.15 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 109425-51-6) is a chemical compound with the molecular formula C40H33N3O4 and a molecular weight of 619.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: XXMYDXUIZKNHDT-QNGWXLTQSA-N.
| Molecular formula | C40H33N3O4 |
|---|---|
| Molecular weight | 619.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | XXMYDXUIZKNHDT-QNGWXLTQSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)