cas: 1159680-21-3 — see every product listed under this CAS number, including other names
Fmoc-HoArg(Pbf)-OH 97% (CAS 1159680-21-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217879-500g |
| cas | 1159680-21-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 26007.94 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 10g | 770.88 Pln | |
| Ambeed | 25g | 1816.62 Pln | |
| Ambeed | 100g | 6555.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217879 |
(2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1159680-21-3) is a chemical compound with the molecular formula C35H42N4O7S and a molecular weight of 662.8 g/mol. IUPAC name: (2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: DOGZBRBJANHMLA-LJAQVGFWSA-N.
| Molecular formula | C35H42N4O7S |
|---|---|
| Molecular weight | 662.8 g/mol |
| IUPAC name | (2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DOGZBRBJANHMLA-LJAQVGFWSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCCC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)