cas: 1159680-21-3 — see every product listed under this CAS number, including other names
N6-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-lysine, 98%, 98% (CAS 1159680-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111H9A-100mg |
| cas | 1159680-21-3 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 100g | 3506.00 Pln | |
| Chemat | 50g | 1854.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1159680-21-3) is a chemical compound with the molecular formula C35H42N4O7S and a molecular weight of 662.8 g/mol. IUPAC name: (2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: DOGZBRBJANHMLA-LJAQVGFWSA-N.
| Molecular formula | C35H42N4O7S |
|---|---|
| Molecular weight | 662.8 g/mol |
| IUPAC name | (2S)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DOGZBRBJANHMLA-LJAQVGFWSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCCC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)