CAS 1260616-15-6 is the registry number for Fmoc–2,5–difluoro–L–homophenylalanine. Offered by: GLPBio. Available pack sizes: 25mg.
(2S)-4-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260616-15-6) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (2S)-4-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: CMOCQWVOWRXWCO-QHCPKHFHSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S)-4-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | CMOCQWVOWRXWCO-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=C(C=CC(=C4)F)F)C(=O)O |
Computed by PubChem (NCBI)