CAS 1956436-07-9 is the registry number for (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2,4-difluorophenyl)butanoic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-4-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1956436-07-9) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (3R)-4-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: RPIFXOAZJWNAFZ-QGZVFWFLSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (3R)-4-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | RPIFXOAZJWNAFZ-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=C(C=C(C=C4)F)F)CC(=O)O |
Computed by PubChem (NCBI)