cas: 1260610-23-8 — see every product listed under this CAS number, including other names
Fmoc-HoPhe(3-OMe)-OH 95% (CAS 1260610-23-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A966021-25mg |
| cas | 1260610-23-8 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 181.25 Pln | |
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1633.06 Pln | |
| Ambeed | 5g | 5532.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A966021 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methoxyphenyl)butanoic acid (CAS 1260610-23-8) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methoxyphenyl)butanoic acid. InChIKey: RPVNNQLYFQJIOS-DEOSSOPVSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methoxyphenyl)butanoic acid |
| InChIKey | RPVNNQLYFQJIOS-DEOSSOPVSA-N |
| SMILES | COC1=CC=CC(=C1)CC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)