cas: 136030-33-6 — see every product listed under this CAS number, including other names
Fmoc-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid, 98%, 98% (CAS 136030-33-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUFN-1g |
| cas | 136030-33-6 |
| size | 1g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 500g | 1440.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CAS 136030-33-6) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid. InChIKey: LIRBCUNCXDZOOU-QHCPKHFHSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (3S)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| InChIKey | LIRBCUNCXDZOOU-QHCPKHFHSA-N |
| SMILES | C1[C@H](N(CC2=CC=CC=C21)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)