CAS 1270295-34-5 appears in our catalog under these names: Fmoc-L-Phe(3,5-Me2)-OH, Fmoc-3,5-dimethyl-L-phenylalanine, Fmoc-L-Phe(3,5-2Me)-OH, 97%. Offered by: Iris Biotech, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(2S)-3-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1270295-34-5) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-3-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: SYSAOASBWBMFGU-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-3-(3,5-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | SYSAOASBWBMFGU-DEOSSOPVSA-N |
| SMILES | CC1=CC(=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)