CAS 219967-74-5 appears in our catalog under these names: Fmoc-β-Nva(5-phenyl)-OH 98%, Fmoc-(S)-3-amino-5-phenylpentanoic acid, 97%, Fmoc–(S)– 3–Amino–5–phenyl–pentanoic acid, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid, 98%, 98%, (S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-5-phenyl-pentanoic acid, 98%. Offered by: Ambeed, Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 219967-74-5) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: FYJRCXFXXJMPFO-IBGZPJMESA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | FYJRCXFXXJMPFO-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)