Fmoc-Lys(Me)3-OH Chloride, 98%, 98%
cas: 201004-29-7 — see every product listed under this CAS number, including other names
Fmoc-Lys(Me)3-OH Chloride, 98%, 98% (CAS 201004-29-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 500g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113D5S-50g |
| cas | 201004-29-7 |
| size | 50g |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 5574.80 Pln | |
| Chemat | 100g | 6549.20 Pln | |
| Chemat | 250g | 14085.20 Pln | |
| Chemat | 500g | 26707.20 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3506.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride (CAS 201004-29-7) is a chemical compound with the molecular formula C24H31ClN2O4 and a molecular weight of 447.0 g/mol. IUPAC name: [(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride. InChIKey: XUJRNPVABVHOAJ-FTBISJDPSA-N.
| Molecular formula | C24H31ClN2O4 |
|---|---|
| Molecular weight | 447.0 g/mol |
| IUPAC name | [(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride |
| InChIKey | XUJRNPVABVHOAJ-FTBISJDPSA-N |
| SMILES | C[N+](C)(C)CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.[Cl-] |
Computed by PubChem (NCBI)