CAS 201004-29-7 appears in our catalog under these names: Fmoc-lys(me)3-oh chloride, 96%, Fmoc–Lys(Me3)–OH, Fmoc–Lys(Me)3–OH Chloride, Fmoc-L-Lys(Me3)-OH*Cl, FMOC-LYS(ME)3-OH CHLORIDE, >=97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 100mg, 10g, 250mg, 2.5G, 500MG, 50g.
[(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride (CAS 201004-29-7) is a chemical compound with the molecular formula C24H31ClN2O4 and a molecular weight of 447.0 g/mol. IUPAC name: [(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride. InChIKey: XUJRNPVABVHOAJ-FTBISJDPSA-N.
| Molecular formula | C24H31ClN2O4 |
|---|---|
| Molecular weight | 447.0 g/mol |
| IUPAC name | [(5S)-5-carboxy-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]-trimethylazanium chloride |
| InChIKey | XUJRNPVABVHOAJ-FTBISJDPSA-N |
| SMILES | C[N+](C)(C)CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.[Cl-] |
Computed by PubChem (NCBI)