Fmoc-Lys-OMe.HCl, 97%
cas: 847658-45-1 — see every product listed under this CAS number, including other names
Fmoc-Lys-OMe.HCl, 97% (CAS 847658-45-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114A5Z-100mg |
| cas | 847658-45-1 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 635.60 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 25g | 1158.51 Pln | |
| BLDpharm | 100g | 4179.66 Pln | |
| BLDpharm | 500g | 16503.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride (CAS 847658-45-1) is a chemical compound with the molecular formula C22H27ClN2O4 and a molecular weight of 418.9 g/mol. IUPAC name: methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride. InChIKey: BFRSKAFOHYTUAS-BDQAORGHSA-N.
| Molecular formula | C22H27ClN2O4 |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride |
| InChIKey | BFRSKAFOHYTUAS-BDQAORGHSA-N |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.Cl |
Computed by PubChem (NCBI)