CAS 2737202-64-9 is the registry number for Fmoc-D-Dap-OtBu HCl 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;hydrochloride (CAS 2737202-64-9) is a chemical compound with the molecular formula C22H27ClN2O4 and a molecular weight of 418.9 g/mol. IUPAC name: tert-butyl (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;hydrochloride. InChIKey: HBBNGRFPZAWXOM-FSRHSHDFSA-N.
| Molecular formula | C22H27ClN2O4 |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | tert-butyl (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;hydrochloride |
| InChIKey | HBBNGRFPZAWXOM-FSRHSHDFSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CN)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.Cl |
Computed by PubChem (NCBI)