cas: 148515-78-0 — see every product listed under this CAS number, including other names
Fmoc-N(Hmb)-Gly-OH, 98%, 98% (CAS 148515-78-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KZ4-100mg |
| cas | 148515-78-0 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 381.20 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1269.20 Pln | |
| Chemat | 100g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl-[(2-hydroxy-4-methoxyphenyl)methyl]amino]acetic acid (CAS 148515-78-0) is a chemical compound with the molecular formula C25H23NO6 and a molecular weight of 433.5 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[(2-hydroxy-4-methoxyphenyl)methyl]amino]acetic acid. InChIKey: SFNQJVQTVYXPFN-UHFFFAOYSA-N.
| Molecular formula | C25H23NO6 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[(2-hydroxy-4-methoxyphenyl)methyl]amino]acetic acid |
| InChIKey | SFNQJVQTVYXPFN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN(CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)