cas: 1821797-58-3 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Allo-Ile-OH 98% (CAS 1821797-58-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1438087-10g |
| cas | 1821797-58-3 |
| size | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 20133.94 Pln | |
| Ambeed | 50mg | 559.50 Pln | |
| Ambeed | 100mg | 898.81 Pln | |
| Ambeed | 250mg | 1744.31 Pln | |
| Ambeed | 1g | 4286.38 Pln | |
| Ambeed | 5g | 12607.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1438087 |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid (CAS 1821797-58-3) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid. InChIKey: IQIOLCJHRZWOLS-VLIAUNLRSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid |
| InChIKey | IQIOLCJHRZWOLS-VLIAUNLRSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)