CAS 1231709-23-1 appears in our catalog under these names: Fmoc–α–Me–D–Leu–OH, (R)-N-Fmoc-alpha-methylleucine, 95%, Fmoc-alpha-Me-D-Leu-OH, Fmoc-α-Me-D-Leu-OH 97%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,4-dimethylpentanoic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid (CAS 1231709-23-1) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid. InChIKey: LKQDQIGTIVQHMG-JOCHJYFZSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid |
| InChIKey | LKQDQIGTIVQHMG-JOCHJYFZSA-N |
| SMILES | CC(C)C[C@](C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)