CAS 1078607-71-2 is the registry number for Fmoc-N-Me-L-Ser(Trt)-OH, ≥99%, ≥99%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-trityloxypropanoic acid (CAS 1078607-71-2) is a chemical compound with the molecular formula C38H33NO5 and a molecular weight of 583.7 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-trityloxypropanoic acid. InChIKey: JNGHYLDUUAEJDZ-DHUJRADRSA-N.
| Molecular formula | C38H33NO5 |
|---|---|
| Molecular weight | 583.7 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-trityloxypropanoic acid |
| InChIKey | JNGHYLDUUAEJDZ-DHUJRADRSA-N |
| SMILES | CN([C@@H](COC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)