CAS 682800-84-6 appears in our catalog under these names: Fmoc-d-thr(trt)-oh, 95%, Fmoc-D-Thr(Trt)-OH, Fmoc-D-Thr(Trt)-OH 95%, Fmoc-D-Thr(Trt)-OH, 95%, 95%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid (CAS 682800-84-6) is a chemical compound with the molecular formula C38H33NO5 and a molecular weight of 583.7 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid. InChIKey: JARBLLDDSTVWSM-OSPAZUARSA-N.
| Molecular formula | C38H33NO5 |
|---|---|
| Molecular weight | 583.7 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid |
| InChIKey | JARBLLDDSTVWSM-OSPAZUARSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)