Fmoc-N-Me-Phe(4-Cl)-OH 98%
cas: 1217716-50-1 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Phe(4-Cl)-OH 98% (CAS 1217716-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A991234-100mg |
| cas | 1217716-50-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 10g | 1221.44 Pln | |
| Ambeed | 25g | 2372.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A991234 |
(2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 1217716-50-1) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: DTVJLZWXYPPOHJ-QHCPKHFHSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S)-3-(4-chlorophenyl)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | DTVJLZWXYPPOHJ-QHCPKHFHSA-N |
| SMILES | CN([C@@H](CC1=CC=C(C=C1)Cl)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)