cas: 84000-14-6 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Ser(Bzl)-OH 98% (CAS 84000-14-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102405-1g |
| cas | 84000-14-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 10g | 954.44 Pln | |
| Ambeed | 25g | 2278.31 Pln | |
| Ambeed | 100g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102405 |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxypropanoic acid (CAS 84000-14-6) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxypropanoic acid. InChIKey: VZPIFUWXIJVTCS-DEOSSOPVSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxypropanoic acid |
| InChIKey | VZPIFUWXIJVTCS-DEOSSOPVSA-N |
| SMILES | CN([C@@H](COCC1=CC=CC=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)