cas: 133373-24-7 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Tyr(tBu)-OH, 95% (CAS 133373-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128315-250mg |
| cas | 133373-24-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 820.94 Pln | |
| Ambeed | 25g | 1777.69 Pln | |
| Ambeed | 100g | 6895.19 Pln | |
| Ambeed | 500g | 27376.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 133373-24-7) is a chemical compound with the molecular formula C29H31NO5 and a molecular weight of 473.6 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: WTLSDEYZKFJXFT-SANMLTNESA-N.
| Molecular formula | C29H31NO5 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | WTLSDEYZKFJXFT-SANMLTNESA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)N(C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)