cas: 133373-24-7 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Tyr(tBu)-OH, 98%, 98% (CAS 133373-24-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 500g, 1kg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125R2-50g |
| cas | 133373-24-7 |
| size | 50g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 2200.40 Pln | |
| Chemat | 100g | 4264.40 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Chemat | 500g | 14155.20 Pln | |
| Chemat | 1kg | 26018.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 1163.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 133373-24-7) is a chemical compound with the molecular formula C29H31NO5 and a molecular weight of 473.6 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: WTLSDEYZKFJXFT-SANMLTNESA-N.
| Molecular formula | C29H31NO5 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | WTLSDEYZKFJXFT-SANMLTNESA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)N(C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)