cas: 71989-38-3 — see every product listed under this CAS number, including other names
Fmoc-O-tert-butyl-L-tyrosine, 98%, 98% (CAS 71989-38-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y8-1g |
| cas | 71989-38-3 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 50g | 150.80 Pln | |
| Chemat | 100g | 232.40 Pln | |
| Chemat | 250g | 482.00 Pln | |
| Chemat | 500g | 960.00 Pln | |
| Chemat | 1kg | 1802.00 Pln | |
| Chemat | 5kg | 7848.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 71989-38-3) is a chemical compound with the molecular formula C28H29NO5 and a molecular weight of 459.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: JAUKCFULLJFBFN-VWLOTQADSA-N.
| Molecular formula | C28H29NO5 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | JAUKCFULLJFBFN-VWLOTQADSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)