cas: 109425-55-0 — see every product listed under this CAS number, including other names
Fmoc-Orn(Boc)-OH, 98%, 98% (CAS 109425-55-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11474Y-1g |
| cas | 109425-55-0 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 50g | 179.60 Pln | |
| Chemat | 100g | 290.00 Pln | |
| Chemat | 250g | 606.80 Pln | |
| Chemat | 500g | 1219.20 Pln | |
| Chemat | 1kg | 2051.60 Pln | |
| Chemat | 5kg | 10435.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 109425-55-0) is a chemical compound with the molecular formula C25H30N2O6 and a molecular weight of 454.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: JOOIZTMAHNLNHE-NRFANRHFSA-N.
| Molecular formula | C25H30N2O6 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | JOOIZTMAHNLNHE-NRFANRHFSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)