CAS 853063-25-9 is the registry number for (2S,4R)-Nα-Cbz-4-N-Boc-aminoproline benzyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibenzyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate (CAS 853063-25-9) is a chemical compound with the molecular formula C25H30N2O6 and a molecular weight of 454.5 g/mol. IUPAC name: dibenzyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate. InChIKey: WSPWUQDILBQHES-RTWAWAEBSA-N.
| Molecular formula | C25H30N2O6 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | dibenzyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,2-dicarboxylate |
| InChIKey | WSPWUQDILBQHES-RTWAWAEBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)