CAS 329223-23-6 appears in our catalog under these names: Fmoc-PEA/ 98.17% (existing batch purity), Fmoc–PEA, Fmoc-PEA, (9H-Fluoren-9-yl)methyl [2-(Phosphonooxy)ethyl]carbamate, >95.0%(HPLC)(qNMR), Fmoc-PEA 95%. Offered by: TargetMol, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
9H-fluoren-9-ylmethyl N-(2-phosphonooxyethyl)carbamate (CAS 329223-23-6) is a chemical compound with the molecular formula C17H18NO6P and a molecular weight of 363.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-phosphonooxyethyl)carbamate. InChIKey: YHUHBHVNOVAEMP-UHFFFAOYSA-N.
| Molecular formula | C17H18NO6P |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-phosphonooxyethyl)carbamate |
| InChIKey | YHUHBHVNOVAEMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOP(=O)(O)O |
Computed by PubChem (NCBI)