Fmoc-PEG4-NHS ester, 98%
cas: 1314378-14-7 — see every product listed under this CAS number, including other names
Fmoc-PEG4-NHS ester, 98% (CAS 1314378-14-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986882-25MG |
| cas | 1314378-14-7 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 383.22 Pln | |
| Fluorochem | 50mg | 388.42 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 10g | 3512.32 Pln | |
| Fluorochem | 25g | 8031.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1314378-14-7) is a chemical compound with the molecular formula C30H36N2O10 and a molecular weight of 584.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: NMCTTZZPHFQEQB-UHFFFAOYSA-N.
| Molecular formula | C30H36N2O10 |
|---|---|
| Molecular weight | 584.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | NMCTTZZPHFQEQB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)