cas: 73724-46-6 — see every product listed under this CAS number, including other names
Fmoc-Ser-OBzl 98% (CAS 73724-46-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199637-250mg |
| cas | 73724-46-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1538.50 Pln | |
| Ambeed | 500g | 3757.94 Pln | |
| Ambeed | 1000g | 6344.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199637 |
Benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate (CAS 73724-46-6) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate. InChIKey: GXJVEJVEJKIXCH-QHCPKHFHSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate |
| InChIKey | GXJVEJVEJKIXCH-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)