CAS 284492-02-0 appears in our catalog under these names: 3-N-Fmoc-3-(4-methoxyphenyl)propionic acid, 95%, 3-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-3-(4-methoxyphenyl)propanoic acid, Fmoc-β-DL-Tyr(Me)-OH 97%, 3-N-Fmoc-3-(4-methoxyphenyl)propionic acid, 97%, 97%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-methoxyphenyl)propanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 0,25g, 10g, 5g, 100mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid (CAS 284492-02-0) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid. InChIKey: GXOCWIPOYXOZAF-UHFFFAOYSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | GXOCWIPOYXOZAF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)