cas: 146346-82-9 — see every product listed under this CAS number, including other names
Fmoc-Thr(TBDMS)-OH, 98%, 98% (CAS 146346-82-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DXM-250mg |
| cas | 146346-82-9 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 146346-82-9) is a chemical compound with the molecular formula C25H33NO5Si and a molecular weight of 455.6 g/mol. IUPAC name: (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LQMPINNWAPYALU-ZHRRBRCNSA-N.
| Molecular formula | C25H33NO5Si |
|---|---|
| Molecular weight | 455.6 g/mol |
| IUPAC name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LQMPINNWAPYALU-ZHRRBRCNSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)