CAS 146346-82-9 appears in our catalog under these names: Fmoc–Thr(TBDMS)–OH, Fmoc-L-Thr(TBDMS)-OH, Fmoc-Thr(TBDMS)-OH, Fmoc-Thr(TBDMS)-OH, 97.00%, Fmoc-Thr(TBDMS)-OH 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Ambeed. Available pack sizes: 10g, 1g, 250mg, 25g, 5g, 500mg, 50g, 100g.
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 146346-82-9) is a chemical compound with the molecular formula C25H33NO5Si and a molecular weight of 455.6 g/mol. IUPAC name: (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LQMPINNWAPYALU-ZHRRBRCNSA-N.
| Molecular formula | C25H33NO5Si |
|---|---|
| Molecular weight | 455.6 g/mol |
| IUPAC name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LQMPINNWAPYALU-ZHRRBRCNSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)