cas: 143824-78-6 — see every product listed under this CAS number, including other names
Fmoc-Trp(Boc)-OH, 95% (CAS 143824-78-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03376-1G |
| cas | 143824-78-6 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 742.46 Pln | |
| Fluorochem | 500g | 3486.29 Pln | |
| Fluorochem | 1kg | 6688.29 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid (CAS 143824-78-6) is a chemical compound with the molecular formula C31H30N2O6 and a molecular weight of 526.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid. InChIKey: ADOHASQZJSJZBT-SANMLTNESA-N.
| Molecular formula | C31H30N2O6 |
|---|---|
| Molecular weight | 526.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
| InChIKey | ADOHASQZJSJZBT-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)