cas: 191348-16-0 — see every product listed under this CAS number, including other names
Fmoc-Tyr(HPO3Bzl)-OH, 97% (CAS 191348-16-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F790976-1G |
| cas | 191348-16-0 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 981.96 Pln | |
| Fluorochem | 10g | 1851.45 Pln | |
| Fluorochem | 25g | 3694.55 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 965.56 Pln | |
| Ambeed | 10g | 1855.56 Pln | |
| Ambeed | 25g | 3635.56 Pln | |
| Ambeed | 100g | 11484.25 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid (CAS 191348-16-0) is a chemical compound with the molecular formula C31H28NO8P and a molecular weight of 573.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid. InChIKey: WNFKGEXQEWKECX-LJAQVGFWSA-N.
| Molecular formula | C31H28NO8P |
|---|---|
| Molecular weight | 573.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid |
| InChIKey | WNFKGEXQEWKECX-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COP(=O)(O)OC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)