cas: 191348-16-0 — see every product listed under this CAS number, including other names
Fmoc-Tyr(HPO3Bzl)-OH, 98%, 98% (CAS 191348-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113F6Y-100g |
| cas | 191348-16-0 |
| size | 100g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5853.20 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid (CAS 191348-16-0) is a chemical compound with the molecular formula C31H28NO8P and a molecular weight of 573.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid. InChIKey: WNFKGEXQEWKECX-LJAQVGFWSA-N.
| Molecular formula | C31H28NO8P |
|---|---|
| Molecular weight | 573.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[hydroxy(phenylmethoxy)phosphoryl]oxyphenyl]propanoic acid |
| InChIKey | WNFKGEXQEWKECX-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COP(=O)(O)OC2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)