Fmoc-Val-Ser(psi(Me,Me)pro)-OH 98%
cas: 186023-49-4 — see every product listed under this CAS number, including other names
Fmoc-Val-Ser(psi(Me,Me)pro)-OH 98% (CAS 186023-49-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A782596-1g |
| cas | 186023-49-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1494.00 Pln | |
| Ambeed | 10g | 2422.94 Pln | |
| Ambeed | 25g | 4481.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A782596 |
(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 186023-49-4) is a chemical compound with the molecular formula C26H30N2O6 and a molecular weight of 466.5 g/mol. IUPAC name: (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: KLYUTTJBDDHKOC-VXKWHMMOSA-N.
| Molecular formula | C26H30N2O6 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | KLYUTTJBDDHKOC-VXKWHMMOSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1[C@@H](COC1(C)C)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Val-Ser(Psime,Mepro)-OH, Fmoc-Val-Ser(Psi(Me,Me)pro)-OH, Fmoc-Val-Ser[Psi(Me,Me)Pro]-OH, Fmoc-L-Val-L-Ser(Psi(Me,Me)pro)-OH, Fmoc-L-Val-L-Ser[PSI(Me,Me)Pro]-OH, Fmoc-Val-Ser(|xMe,Mepro)-OH, FMOC-VAL-SER(PsiME,ME PRO)-OH_186023-49-4, Fmoc-Val-Ser[Psi(Me,Me)Pro]-OH>/= 99% (HPLC), (9H-Fluoren-9-yl)MethOxy]Carbonyl Val-SerPsi(Me,Me)Pro-OH