cas: 186023-49-4 — see every product listed under this CAS number, including other names
Fmoc-Val-Ser[Psi(Me,Me)Pro]-OH, 98%, 98% (CAS 186023-49-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACR6-1g |
| cas | 186023-49-4 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 25g | 1158.80 Pln | |
| Chemat | 50g | 1528.40 Pln | |
| Chemat | 100g | 2637.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 186023-49-4) is a chemical compound with the molecular formula C26H30N2O6 and a molecular weight of 466.5 g/mol. IUPAC name: (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: KLYUTTJBDDHKOC-VXKWHMMOSA-N.
| Molecular formula | C26H30N2O6 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | KLYUTTJBDDHKOC-VXKWHMMOSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1[C@@H](COC1(C)C)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)