Fmoc-peg2-nhs ester, 98%
cas: 1807534-85-5 — see every product listed under this CAS number, including other names
Fmoc-peg2-nhs ester, 98% (CAS 1807534-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A756083-250mg |
| cas | 1807534-85-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1549.62 Pln | |
| Ambeed | 5g | 4859.31 Pln | |
| BLDpharm | 100mg | 469.86 Pln | |
| BLDpharm | 250mg | 780.86 Pln | |
| BLDpharm | 1g | 1669.44 Pln | |
| BLDpharm | 5g | 4257.41 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 1643.60 Pln | |
| Chemat | 10g | 2891.60 Pln | |
| Chemat | 25g | 5152.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate (CAS 1807534-85-5) is a chemical compound with the molecular formula C26H28N2O8 and a molecular weight of 496.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate. InChIKey: MLMVUZTWJNGUEN-UHFFFAOYSA-N.
| Molecular formula | C26H28N2O8 |
|---|---|
| Molecular weight | 496.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate |
| InChIKey | MLMVUZTWJNGUEN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
