cas: 1332837-31-6 — see every product listed under this CAS number, including other names
Fosifloxuridine nafalbenamide (CAS 1332837-31-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC62645-10 |
| cas | 1332837-31-6 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1973.11 Pln | |
| GLPBio | 100mg | 7491.42 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1865.46 Pln | |
| GLPBio | 25mg | 3531.71 Pln | |
| GLPBio | 5mg | 1491.02 Pln | |
| GLPBio | 50mg | 5132.44 Pln | |
| Chemat | 50mg | 4034.00 Pln | |
| Chemat | 100mg | 5656.40 Pln | |
| Chemat | 1mg | 621.20 Pln | |
| Chemat | 5mg | 1187.60 Pln | |
| Chemat | 10mg | 1653.20 Pln | |
| Chemat | 25mg | 2901.20 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (CAS 1332837-31-6) is a chemical compound with the molecular formula C29H29FN3O9P and a molecular weight of 613.5 g/mol. IUPAC name: benzyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate. InChIKey: BIOWRMNRHMERIO-ZVAHOJSLSA-N.
| Molecular formula | C29H29FN3O9P |
|---|---|
| Molecular weight | 613.5 g/mol |
| IUPAC name | benzyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| InChIKey | BIOWRMNRHMERIO-ZVAHOJSLSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)NP(=O)(OC[C@@H]2[C@H](C[C@@H](O2)N3C=C(C(=O)NC3=O)F)O)OC4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)