Products 1563007-08-8
CAS 1563007-08-8 appears in our catalog under these names: G244-LM/ 98.46% (existing batch purity), G244–LM, G244-LM, G244-LM, 98.32%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 25 mg, 50 mg.
2-[4-(2-methylsulfonylphenyl)piperazin-1-yl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one (CAS 1563007-08-8) is a chemical compound with the molecular formula C18H22N4O3S2 and a molecular weight of 406.5 g/mol. IUPAC name: 2-[4-(2-methylsulfonylphenyl)piperazin-1-yl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one. InChIKey: JSQPAEVPPSCQMV-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O3S2 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 2-[4-(2-methylsulfonylphenyl)piperazin-1-yl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| InChIKey | JSQPAEVPPSCQMV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1N2CCN(CC2)C3=NC4=C(CSCC4)C(=O)N3 |
Computed by PubChem (NCBI)