CAS 2244035-16-1 appears in our catalog under these names: G907, 98%, G907/ 98.14% (existing batch purity), G907, G907, 98.14%, 98.14%, G907, 98.06%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 5 mg.
(E)-3-[6-[1-(2-chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropylquinolin-3-yl]prop-2-enoic acid (CAS 2244035-16-1) is a chemical compound with the molecular formula C26H24ClNO3 and a molecular weight of 433.9 g/mol. IUPAC name: (E)-3-[6-[1-(2-chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropylquinolin-3-yl]prop-2-enoic acid. InChIKey: HOMQCLNBKVHZGD-FMIVXFBMSA-N.
| Molecular formula | C26H24ClNO3 |
|---|---|
| Molecular weight | 433.9 g/mol |
| IUPAC name | (E)-3-[6-[1-(2-chloro-6-cyclopropylphenyl)ethoxy]-4-cyclopropylquinolin-3-yl]prop-2-enoic acid |
| InChIKey | HOMQCLNBKVHZGD-FMIVXFBMSA-N |
| SMILES | CC(C1=C(C=CC=C1Cl)C2CC2)OC3=CC4=C(C(=CN=C4C=C3)/C=C/C(=O)O)C5CC5 |
Computed by PubChem (NCBI)