cas: 1258292-64-6 — see every product listed under this CAS number, including other names
GDC046 99% NMR (CAS 1258292-64-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1325556-5mg |
| cas | 1258292-64-6 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 548.38 Pln | |
| Ambeed | 10mg | 765.31 Pln | |
| Ambeed | 25mg | 1204.75 Pln | |
| Ambeed | 50mg | 1877.81 Pln | |
| Ambeed | 100mg | 2956.94 Pln | |
| Ambeed | 250mg | 5660.31 Pln |
| purity | 99% NMR |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1325556 |
2,6-dichloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]benzamide (CAS 1258292-64-6) is a chemical compound with the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.2 g/mol. IUPAC name: 2,6-dichloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]benzamide. InChIKey: IAFNAEGXTKTGHN-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3O2 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 2,6-dichloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]benzamide |
| InChIKey | IAFNAEGXTKTGHN-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=NC=CC(=C2)NC(=O)C3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)